C22H33N5O — CID 70409605
3-[(6aR,9S)-2-(dimethylamino)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea (PubChem CID 70409605) has the molecular formula C22H33N5O and a molecular weight of 383.54 g/mol. Its IUPAC name is 3-[(6aR,9S)-2-(dimethylamino)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,9S)-2-(dimethylamino)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 70409605 |
| Molecular Formula | C22H33N5O |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | 3-[(6aR,9S)-2-(dimethylamino)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)N[C@H]1CC2c3cc(N(C)C)cc4[nH]cc(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C22H33N5O/c1-6-27(7-2)22(28)24-15-9-17-18-10-16(25(3)4)11-19-21(18)14(12-23-19)8-20(17)26(5)13-15/h10-12,15,17,20,23H,6-9,13H2,1-5H3,(H,24,28)/t15-,17?,20+/m0/s1 |
| InChIKey | SFHMXVWVMUKHNS-UUAFEJJZSA-N |
| XLogP | 3.00 |
| TPSA | 54.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |