C20H29N5O — CID 70409614
3-[(6aR,9R)-2-amino-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea (PubChem CID 70409614) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is 3-[(6aR,9R)-2-amino-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,9R)-2-amino-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 70409614 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 3-[(6aR,9R)-2-amino-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)N[C@@H]1CC2c3cc(N)cc4[nH]cc(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C20H29N5O/c1-4-25(5-2)20(26)23-14-9-15-16-7-13(21)8-17-19(16)12(10-22-17)6-18(15)24(3)11-14/h7-8,10,14-15,18,22H,4-6,9,11,21H2,1-3H3,(H,23,26)/t14-,15?,18-/m1/s1 |
| InChIKey | ZVTBUOOMKNKCGT-KZXIYFNPSA-N |
| XLogP | 2.51 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|