C24H36N4O2 — CID 67788699
3-[(6aR,9S,10aR)-2-(2-hydroxypropan-2-yl)-5,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea (PubChem CID 67788699) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 3-[(6aR,9S,10aR)-2-(2-hydroxypropan-2-yl)-5,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,9S,10aR)-2-(2-hydroxypropan-2-yl)-5,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 67788699 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 3-[(6aR,9S,10aR)-2-(2-hydroxypropan-2-yl)-5,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)N[C@H]1C[C@@H]2c3cc(C(C)(C)O)cc4[nH]c(C)c(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C24H36N4O2/c1-7-28(8-2)23(29)26-16-11-18-19-9-15(24(4,5)30)10-20-22(19)17(14(3)25-20)12-21(18)27(6)13-16/h9-10,16,18,21,25,30H,7-8,11-13H2,1-6H3,(H,26,29)/t16-,18+,21+/m0/s1 |
| InChIKey | FPODAAXAEIUWAF-YRISNDGFSA-N |
| XLogP | 3.47 |
| TPSA | 71.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |