C20H28N2OS — CID 67885650
[(6aR,9R)-9-(methylsulfanylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-5-yl]methanol (PubChem CID 67885650) has the molecular formula C20H28N2OS and a molecular weight of 344.52 g/mol. Its IUPAC name is [(6aR,9R)-9-(methylsulfanylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-5-yl]methanol.
| Compound Name | [(6aR,9R)-9-(methylsulfanylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-5-yl]methanol |
|---|---|
| PubChem CID | 67885650 |
| Molecular Formula | C20H28N2OS |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | [(6aR,9R)-9-(methylsulfanylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-5-yl]methanol |
| SMILES | CCCN1C[C@H](CSC)CC2c3cccc4[nH]c(CO)c(c34)C[C@H]21 |
| InChI | InChI=1S/C20H28N2OS/c1-3-7-22-10-13(12-24-2)8-15-14-5-4-6-17-20(14)16(9-19(15)22)18(11-23)21-17/h4-6,13,15,19,21,23H,3,7-12H2,1-2H3/t13-,15?,19-/m1/s1 |
| InChIKey | JOTBXDOCXPYWKI-LGRPBYAZSA-N |
| XLogP | 3.76 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |