C21H26N2S — CID 57132459
(6aR,10aR)-5-ethenyl-9-(methylsulfanylmethyl)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 57132459) has the molecular formula C21H26N2S and a molecular weight of 338.52 g/mol. Its IUPAC name is (6aR,10aR)-5-ethenyl-9-(methylsulfanylmethyl)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (6aR,10aR)-5-ethenyl-9-(methylsulfanylmethyl)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 57132459 |
| Molecular Formula | C21H26N2S |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (6aR,10aR)-5-ethenyl-9-(methylsulfanylmethyl)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | C=CCN1CC(CSC)C[C@@H]2c3cccc4[nH]c(C=C)c(c34)C[C@H]21 |
| InChI | InChI=1S/C21H26N2S/c1-4-9-23-12-14(13-24-3)10-16-15-7-6-8-19-21(15)17(11-20(16)23)18(5-2)22-19/h4-8,14,16,20,22H,1-2,9-13H2,3H3/t14?,16-,20-/m1/s1 |
| InChIKey | KRNBOKYGBYNONH-ANGYQSCVSA-N |
| XLogP | 4.69 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|