C22H26N4OS — CID 88654900
1-[[(6aR,9R)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-3-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 88654900) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is 1-[[(6aR,9R)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-3-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 1-[[(6aR,9R)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-3-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 88654900 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1-[[(6aR,9R)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-3-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | C=CCN1C[C@H](CN2CC(=O)N(C)C2=S)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C22H26N4OS/c1-3-7-25-11-14(12-26-13-20(27)24(2)22(26)28)8-17-16-5-4-6-18-21(16)15(10-23-18)9-19(17)25/h3-6,10,14,17,19,23H,1,7-9,11-13H2,2H3/t14-,17?,19-/m1/s1 |
| InChIKey | OTAWFGVJFXEUKO-LJMFKLJISA-N |
| XLogP | 2.74 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|