C18H22N2S — CID 90108117
3-[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]propanethial (PubChem CID 90108117) has the molecular formula C18H22N2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 3-[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]propanethial.
| Compound Name | 3-[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]propanethial |
|---|---|
| PubChem CID | 90108117 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 3-[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]propanethial |
| SMILES | CN1C[C@H](CCC=S)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C18H22N2S/c1-20-11-12(4-3-7-21)8-15-14-5-2-6-16-18(14)13(10-19-16)9-17(15)20/h2,5-7,10,12,15,17,19H,3-4,8-9,11H2,1H3/t12-,15?,17-/m1/s1 |
| InChIKey | YAJCBSXRLDATBK-XURPUJGUSA-N |
| XLogP | 3.91 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|