C22H27N3O — CID 22823127
3-[[(6aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methylamino]cyclohex-2-en-1-one (PubChem CID 22823127) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 3-[[(6aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methylamino]cyclohex-2-en-1-one.
| Compound Name | 3-[[(6aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methylamino]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 22823127 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 3-[[(6aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methylamino]cyclohex-2-en-1-one |
| SMILES | CN1CC(CNC2=CC(=O)CCC2)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C22H27N3O/c1-25-13-14(11-23-16-4-2-5-17(26)10-16)8-19-18-6-3-7-20-22(18)15(12-24-20)9-21(19)25/h3,6-7,10,12,14,19,21,23-24H,2,4-5,8-9,11,13H2,1H3/t14?,19?,21-/m1/s1 |
| InChIKey | CQPXPLVCYWNCEI-XATSIWNJSA-N |
| XLogP | 3.35 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |