C18H24N4O — CID 57020678
N'-[[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]acetohydrazide (PubChem CID 57020678) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N'-[[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]acetohydrazide.
| Compound Name | N'-[[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]acetohydrazide |
|---|---|
| PubChem CID | 57020678 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N'-[[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]acetohydrazide |
| SMILES | CC(=O)NNCC1C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C18H24N4O/c1-11(23)21-20-8-12-6-15-14-4-3-5-16-18(14)13(9-19-16)7-17(15)22(2)10-12/h3-5,9,12,15,17,19-20H,6-8,10H2,1-2H3,(H,21,23)/t12?,15-,17-/m1/s1 |
| InChIKey | SXSBORPBHTXDGA-VUOSCMKMSA-N |
| XLogP | 1.77 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|