C23H25FN4O — CID 22813105
N'-[[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-4-fluorobenzohydrazide (PubChem CID 22813105) has the molecular formula C23H25FN4O and a molecular weight of 392.48 g/mol. Its IUPAC name is N'-[[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 22813105 |
| Molecular Formula | C23H25FN4O |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N'-[[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-4-fluorobenzohydrazide |
| SMILES | CN1C[C@H](CNNC(=O)c2ccc(F)cc2)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C23H25FN4O/c1-28-13-14(11-26-27-23(29)15-5-7-17(24)8-6-15)9-19-18-3-2-4-20-22(18)16(12-25-20)10-21(19)28/h2-8,12,14,19,21,25-26H,9-11,13H2,1H3,(H,27,29)/t14-,19?,21+/m0/s1 |
| InChIKey | ARXUNUPHVCDVNJ-XTAYQOGCSA-N |
| XLogP | 3.20 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|