C22H30N4O3 — CID 70424648
ethyl 2-[[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methylcarbamoyl-methylamino]acetate (PubChem CID 70424648) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is ethyl 2-[[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methylcarbamoyl-methylamino]acetate.
| Compound Name | ethyl 2-[[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methylcarbamoyl-methylamino]acetate |
|---|---|
| PubChem CID | 70424648 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | ethyl 2-[[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methylcarbamoyl-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)C(=O)NCC1C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C22H30N4O3/c1-4-29-20(27)13-26(3)22(28)24-10-14-8-17-16-6-5-7-18-21(16)15(11-23-18)9-19(17)25(2)12-14/h5-7,11,14,17,19,23H,4,8-10,12-13H2,1-3H3,(H,24,28)/t14?,17-,19-/m1/s1 |
| InChIKey | HQFNVJHYIJOHFM-POWSATBFSA-N |
| XLogP | 2.33 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |