C27H35N3O8 — CID 6446086
2-[(6aR,9S)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-ethylethanamine;bis((E)-but-2-enedioic acid) (PubChem CID 6446086) has the molecular formula C27H35N3O8 and a molecular weight of 529.59 g/mol. Its IUPAC name is 2-[(6aR,9S)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-ethylethanamine;bis((E)-but-2-enedioic acid).
| Compound Name | 2-[(6aR,9S)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-ethylethanamine;bis((E)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 6446086 |
| Molecular Formula | C27H35N3O8 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 2-[(6aR,9S)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-ethylethanamine;bis((E)-but-2-enedioic acid) |
| SMILES | CCNCC[C@@H]1CC2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H27N3.2C4H4O4/c1-3-20-8-7-13-9-16-15-5-4-6-17-19(15)14(11-21-17)10-18(16)22(2)12-13;2*5-3(6)1-2-4(7)8/h4-6,11,13,16,18,20-21H,3,7-10,12H2,1-2H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+/t13-,16?,18-;;/m1../s1 |
| InChIKey | YJQGZPJJLNCZHM-QBEHYCQBSA-N |
| XLogP | 2.55 |
| TPSA | 180.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|