C22H25N5O4 — CID 85060462
but-2-enedioic acid;7-methyl-9-(1,2,4-triazol-1-ylmethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 85060462) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is but-2-enedioic acid;7-methyl-9-(1,2,4-triazol-1-ylmethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | but-2-enedioic acid;7-methyl-9-(1,2,4-triazol-1-ylmethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 85060462 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | but-2-enedioic acid;7-methyl-9-(1,2,4-triazol-1-ylmethyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | CN1CC(Cn2cncn2)CC2c3cccc4[nH]cc(c34)CC21.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H21N5.C4H4O4/c1-22-8-12(9-23-11-19-10-21-23)5-15-14-3-2-4-16-18(14)13(7-20-16)6-17(15)22;5-3(6)1-2-4(7)8/h2-4,7,10-12,15,17,20H,5-6,8-9H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | MNIXOHSBCFNRSH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 124.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|