C21H26N4O2 — CID 10785133
1-[2-[(6aR,9S,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]ethyl]-1,3-diazinane-2,4-dione (PubChem CID 10785133) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 1-[2-[(6aR,9S,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]ethyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-[(6aR,9S,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]ethyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 10785133 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-[2-[(6aR,9S,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]ethyl]-1,3-diazinane-2,4-dione |
| SMILES | CN1C[C@H](CCN2CCC(=O)NC2=O)C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C21H26N4O2/c1-24-12-13(5-7-25-8-6-19(26)23-21(25)27)9-16-15-3-2-4-17-20(15)14(11-22-17)10-18(16)24/h2-4,11,13,16,18,22H,5-10,12H2,1H3,(H,23,26,27)/t13-,16-,18-/m1/s1 |
| InChIKey | RRIVJHOEJOWMOP-MZMPZRCHSA-N |
| XLogP | 2.46 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |