C21H26N4 — CID 57210885
(6aR,10aR)-9-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 57210885) has the molecular formula C21H26N4 and a molecular weight of 334.47 g/mol. Its IUPAC name is (6aR,10aR)-9-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (6aR,10aR)-9-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 57210885 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | (6aR,10aR)-9-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | Cc1n[nH]c(C)c1CC1C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C21H26N4/c1-12-17(13(2)24-23-12)7-14-8-18-16-5-4-6-19-21(16)15(10-22-19)9-20(18)25(3)11-14/h4-6,10,14,18,20,22H,7-9,11H2,1-3H3,(H,23,24)/t14?,18-,20-/m1/s1 |
| InChIKey | XKQGTVLROWPFTC-DAQNAQFFSA-N |
| XLogP | 3.71 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |