C33H38N4 — CID 70119202
(6aR,9S,10aR)-9-[(4-benzhydrylpiperazin-1-yl)methyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 70119202) has the molecular formula C33H38N4 and a molecular weight of 490.70 g/mol. Its IUPAC name is (6aR,9S,10aR)-9-[(4-benzhydrylpiperazin-1-yl)methyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (6aR,9S,10aR)-9-[(4-benzhydrylpiperazin-1-yl)methyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 70119202 |
| Molecular Formula | C33H38N4 |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | (6aR,9S,10aR)-9-[(4-benzhydrylpiperazin-1-yl)methyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | CN1C[C@H](CN2CCN(C(c3ccccc3)c3ccccc3)CC2)C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C33H38N4/c1-35-22-24(19-29-28-13-8-14-30-32(28)27(21-34-30)20-31(29)35)23-36-15-17-37(18-16-36)33(25-9-4-2-5-10-25)26-11-6-3-7-12-26/h2-14,21,24,29,31,33-34H,15-20,22-23H2,1H3/t24-,29-,31-/m1/s1 |
| InChIKey | QEUPKSIGEGYOEP-FGPAUOPCSA-N |
| XLogP | 5.54 |
| TPSA | 25.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |