C20H26N2O3S2 — CID 88783180
[(6aS,10aS)-9-(methylsulfanylmethyl)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl] methanesulfonate (PubChem CID 88783180) has the molecular formula C20H26N2O3S2 and a molecular weight of 406.57 g/mol. Its IUPAC name is [(6aS,10aS)-9-(methylsulfanylmethyl)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl] methanesulfonate.
| Compound Name | [(6aS,10aS)-9-(methylsulfanylmethyl)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 88783180 |
| Molecular Formula | C20H26N2O3S2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | [(6aS,10aS)-9-(methylsulfanylmethyl)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl] methanesulfonate |
| SMILES | C=CCN1CC(CSC)C[C@H]2c3cccc4c3c(cn4OS(C)(=O)=O)C[C@@H]21 |
| InChI | InChI=1S/C20H26N2O3S2/c1-4-8-21-11-14(13-26-2)9-17-16-6-5-7-18-20(16)15(10-19(17)21)12-22(18)25-27(3,23)24/h4-7,12,14,17,19H,1,8-11,13H2,2-3H3/t14?,17-,19-/m0/s1 |
| InChIKey | INCZUVCKFLUSJP-WGAGKFISSA-N |
| XLogP | 2.91 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|