C29H40N2O3 — CID 18610676
3-(oxan-4-yl)propyl (6aR,9R)-7-prop-2-enyl-4-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate (PubChem CID 18610676) has the molecular formula C29H40N2O3 and a molecular weight of 464.65 g/mol. Its IUPAC name is 3-(oxan-4-yl)propyl (6aR,9R)-7-prop-2-enyl-4-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate.
| Compound Name | 3-(oxan-4-yl)propyl (6aR,9R)-7-prop-2-enyl-4-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 18610676 |
| Molecular Formula | C29H40N2O3 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | 3-(oxan-4-yl)propyl (6aR,9R)-7-prop-2-enyl-4-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate |
| SMILES | C=CCN1C[C@H](C(=O)OCCCC2CCOCC2)CC2c3cccc4c3c(cn4CCC)C[C@H]21 |
| InChI | InChI=1S/C29H40N2O3/c1-3-12-30-19-22-18-27-25(24-8-5-9-26(30)28(22)24)17-23(20-31(27)13-4-2)29(32)34-14-6-7-21-10-15-33-16-11-21/h4-5,8-9,19,21,23,25,27H,2-3,6-7,10-18,20H2,1H3/t23-,25?,27-/m1/s1 |
| InChIKey | MVJGCIJCOSGFCE-TXQBPDISSA-N |
| XLogP | 5.32 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|