C18H22N2O2 — CID 12818190
4-ethyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylic acid (PubChem CID 12818190) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-ethyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylic acid.
| Compound Name | 4-ethyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylic acid |
|---|---|
| PubChem CID | 12818190 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 4-ethyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylic acid |
| SMILES | CCn1cc2c3c(cccc31)C1CC(C(=O)O)CN(C)C1C2 |
| InChI | InChI=1S/C18H22N2O2/c1-3-20-10-11-8-16-14(7-12(18(21)22)9-19(16)2)13-5-4-6-15(20)17(11)13/h4-6,10,12,14,16H,3,7-9H2,1-2H3,(H,21,22) |
| InChIKey | QPSBGDFCKNDDLA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|