C29H40N2O6 — CID 67833286
butanedioic acid;cyclohexyl (6aR,9R)-4,7-diethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate (PubChem CID 67833286) has the molecular formula C29H40N2O6 and a molecular weight of 512.65 g/mol. Its IUPAC name is butanedioic acid;cyclohexyl (6aR,9R)-4,7-diethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate.
| Compound Name | butanedioic acid;cyclohexyl (6aR,9R)-4,7-diethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 67833286 |
| Molecular Formula | C29H40N2O6 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | butanedioic acid;cyclohexyl (6aR,9R)-4,7-diethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate |
| SMILES | CCN1C[C@H](C(=O)OC2CCCCC2)CC2c3cccc4c3c(cn4CC)C[C@H]21.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C25H34N2O2.C4H6O4/c1-3-26-15-17-14-23-21(20-11-8-12-22(26)24(17)20)13-18(16-27(23)4-2)25(28)29-19-9-6-5-7-10-19;5-3(6)1-2-4(7)8/h8,11-12,15,18-19,21,23H,3-7,9-10,13-14,16H2,1-2H3;1-2H2,(H,5,6)(H,7,8)/t18-,21?,23-;/m1./s1 |
| InChIKey | DFKUWVCUCHNYLZ-XVIIZMCHSA-N |
| XLogP | 4.82 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|