C30H34N2O4 — CID 70429961
[2-(3-hydroxyphenyl)-2-oxoethyl] (6aR,9R,10aR)-4-(cyclopropylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate (PubChem CID 70429961) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is [2-(3-hydroxyphenyl)-2-oxoethyl] (6aR,9R,10aR)-4-(cyclopropylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate.
| Compound Name | [2-(3-hydroxyphenyl)-2-oxoethyl] (6aR,9R,10aR)-4-(cyclopropylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 70429961 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | [2-(3-hydroxyphenyl)-2-oxoethyl] (6aR,9R,10aR)-4-(cyclopropylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate |
| SMILES | CCCN1C[C@H](C(=O)OCC(=O)c2cccc(O)c2)C[C@@H]2c3cccc4c3c(cn4CC3CC3)C[C@H]21 |
| InChI | InChI=1S/C30H34N2O4/c1-2-11-31-17-22(30(35)36-18-28(34)20-5-3-6-23(33)12-20)13-25-24-7-4-8-26-29(24)21(14-27(25)31)16-32(26)15-19-9-10-19/h3-8,12,16,19,22,25,27,33H,2,9-11,13-15,17-18H2,1H3/t22-,25-,27-/m1/s1 |
| InChIKey | DZXNWSVAYJZIIM-AVPJRLCVSA-N |
| XLogP | 4.92 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|