C26H38N2O7S — CID 70430476
3-ethoxypropyl (6aR,9R)-7-prop-2-enyl-4-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate;sulfuric acid (PubChem CID 70430476) has the molecular formula C26H38N2O7S and a molecular weight of 522.66 g/mol. Its IUPAC name is 3-ethoxypropyl (6aR,9R)-7-prop-2-enyl-4-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate;sulfuric acid.
| Compound Name | 3-ethoxypropyl (6aR,9R)-7-prop-2-enyl-4-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate;sulfuric acid |
|---|---|
| PubChem CID | 70430476 |
| Molecular Formula | C26H38N2O7S |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 3-ethoxypropyl (6aR,9R)-7-prop-2-enyl-4-propyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate;sulfuric acid |
| SMILES | C=CCN1C[C@H](C(=O)OCCCOCC)CC2c3cccc4c3c(cn4CCC)C[C@H]21.O=S(=O)(O)O |
| InChI | InChI=1S/C26H36N2O3.H2O4S/c1-4-11-27-17-19-16-24-22(21-9-7-10-23(27)25(19)21)15-20(18-28(24)12-5-2)26(29)31-14-8-13-30-6-3;1-5(2,3)4/h5,7,9-10,17,20,22,24H,2,4,6,8,11-16,18H2,1,3H3;(H2,1,2,3,4)/t20-,22?,24-;/m1./s1 |
| InChIKey | TYVHTQFNBGUUIL-REOPMXGXSA-N |
| XLogP | 3.88 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|