C26H37N5O2 — CID 59841565
[(6aR,9R,10aR)-9-[3-(dimethylamino)propylcarbamoyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl] N-ethylmethanimidate (PubChem CID 59841565) has the molecular formula C26H37N5O2 and a molecular weight of 451.62 g/mol. Its IUPAC name is [(6aR,9R,10aR)-9-[3-(dimethylamino)propylcarbamoyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl] N-ethylmethanimidate.
| Compound Name | [(6aR,9R,10aR)-9-[3-(dimethylamino)propylcarbamoyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl] N-ethylmethanimidate |
|---|---|
| PubChem CID | 59841565 |
| Molecular Formula | C26H37N5O2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | [(6aR,9R,10aR)-9-[3-(dimethylamino)propylcarbamoyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl] N-ethylmethanimidate |
| SMILES | C=CCN1C[C@H](C(=O)NCCCN(C)C)C[C@@H]2c3cccc4c3c(cn4O/C=N/CC)C[C@H]21 |
| InChI | InChI=1S/C26H37N5O2/c1-5-12-30-16-20(26(32)28-11-8-13-29(3)4)14-22-21-9-7-10-23-25(21)19(15-24(22)30)17-31(23)33-18-27-6-2/h5,7,9-10,17-18,20,22,24H,1,6,8,11-16H2,2-4H3,(H,28,32)/b27-18+/t20-,22-,24-/m1/s1 |
| InChIKey | NOZWSRIEKDJXIQ-BJYNRPNNSA-N |
| XLogP | 2.70 |
| TPSA | 62.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|