C23H30N4O2 — CID 89200297
(6aR,9R)-N-[ethyl(methyl)carbamoyl]-4-methyl-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 89200297) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is (6aR,9R)-N-[ethyl(methyl)carbamoyl]-4-methyl-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-N-[ethyl(methyl)carbamoyl]-4-methyl-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 89200297 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (6aR,9R)-N-[ethyl(methyl)carbamoyl]-4-methyl-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | C=CCN1C[C@H](C(=O)NC(=O)N(C)CC)CC2c3cccc4c3c(cn4C)C[C@H]21 |
| InChI | InChI=1S/C23H30N4O2/c1-5-10-27-14-16(22(28)24-23(29)25(3)6-2)11-18-17-8-7-9-19-21(17)15(12-20(18)27)13-26(19)4/h5,7-9,13,16,18,20H,1,6,10-12,14H2,2-4H3,(H,24,28,29)/t16-,18?,20-/m1/s1 |
| InChIKey | HITUTHODQLDHSJ-OPZSGVPXSA-N |
| XLogP | 2.88 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|