C24H28N4O — CID 57074368
(6aR,10aR)-4,7-dimethyl-N-(2-pyridin-2-ylethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 57074368) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is (6aR,10aR)-4,7-dimethyl-N-(2-pyridin-2-ylethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,10aR)-4,7-dimethyl-N-(2-pyridin-2-ylethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 57074368 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | (6aR,10aR)-4,7-dimethyl-N-(2-pyridin-2-ylethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CN1CC(C(=O)NCCc2ccccn2)C[C@@H]2c3cccc4c3c(cn4C)C[C@H]21 |
| InChI | InChI=1S/C24H28N4O/c1-27-14-16-13-22-20(19-7-5-8-21(27)23(16)19)12-17(15-28(22)2)24(29)26-11-9-18-6-3-4-10-25-18/h3-8,10,14,17,20,22H,9,11-13,15H2,1-2H3,(H,26,29)/t17?,20-,22-/m1/s1 |
| InChIKey | LUWCLZCOZALXCL-SXHSKPAUSA-N |
| XLogP | 2.89 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|