C25H29N3O2 — CID 91507582
benzyl N-[(6aR,9R)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-N-methylcarbamate (PubChem CID 91507582) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is benzyl N-[(6aR,9R)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-N-methylcarbamate.
| Compound Name | benzyl N-[(6aR,9R)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 91507582 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | benzyl N-[(6aR,9R)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-N-methylcarbamate |
| SMILES | CN1C[C@H](N(C)C(=O)OCc2ccccc2)CC2c3cccc4c3c(cn4C)C[C@H]21 |
| InChI | InChI=1S/C25H29N3O2/c1-26-14-18-12-23-21(20-10-7-11-22(26)24(18)20)13-19(15-27(23)2)28(3)25(29)30-16-17-8-5-4-6-9-17/h4-11,14,19,21,23H,12-13,15-16H2,1-3H3/t19-,21?,23-/m1/s1 |
| InChIKey | UNUQKDCIKZKBAG-DICHZYRTSA-N |
| XLogP | 4.16 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|