C26H31N3O2 — CID 70303848
benzyl N-[1-[(6aR,9R,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl]carbamate (PubChem CID 70303848) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is benzyl N-[1-[(6aR,9R,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl]carbamate.
| Compound Name | benzyl N-[1-[(6aR,9R,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 70303848 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | benzyl N-[1-[(6aR,9R,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl]carbamate |
| SMILES | CC(NC(=O)OCc1ccccc1)[C@@H]1C[C@@H]2c3cccc4c3c(cn4C)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C26H31N3O2/c1-17(27-26(30)31-16-18-8-5-4-6-9-18)19-12-22-21-10-7-11-23-25(21)20(15-28(23)2)13-24(22)29(3)14-19/h4-11,15,17,19,22,24H,12-14,16H2,1-3H3,(H,27,30)/t17?,19-,22-,24-/m1/s1 |
| InChIKey | MUDHUPCCGJKTFB-FNIZMKIOSA-N |
| XLogP | 4.45 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|