C25H33N5O — CID 70358552
(6aR,9R,10aR)-N-[2-(1H-imidazol-5-yl)pentyl]-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 70358552) has the molecular formula C25H33N5O and a molecular weight of 419.57 g/mol. Its IUPAC name is (6aR,9R,10aR)-N-[2-(1H-imidazol-5-yl)pentyl]-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R,10aR)-N-[2-(1H-imidazol-5-yl)pentyl]-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 70358552 |
| Molecular Formula | C25H33N5O |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | (6aR,9R,10aR)-N-[2-(1H-imidazol-5-yl)pentyl]-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCCC(CNC(=O)[C@@H]1C[C@@H]2c3cccc4c3c(cn4C)C[C@H]2N(C)C1)c1cnc[nH]1 |
| InChI | InChI=1S/C25H33N5O/c1-4-6-16(21-12-26-15-28-21)11-27-25(31)18-9-20-19-7-5-8-22-24(19)17(13-29(22)2)10-23(20)30(3)14-18/h5,7-8,12-13,15-16,18,20,23H,4,6,9-11,14H2,1-3H3,(H,26,28)(H,27,31)/t16?,18-,20-,23-/m1/s1 |
| InChIKey | WKLABJAZZASGFI-KYWJOTIBSA-N |
| XLogP | 3.56 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|