C25H30N4O — CID 14653085
(6aR,9R,10aR)-7-methyl-4-propan-2-yl-N-(pyridin-3-ylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 14653085) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is (6aR,9R,10aR)-7-methyl-4-propan-2-yl-N-(pyridin-3-ylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R,10aR)-7-methyl-4-propan-2-yl-N-(pyridin-3-ylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 14653085 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (6aR,9R,10aR)-7-methyl-4-propan-2-yl-N-(pyridin-3-ylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CC(C)n1cc2c3c(cccc31)[C@H]1C[C@@H](C(=O)NCc3cccnc3)CN(C)[C@@H]1C2 |
| InChI | InChI=1S/C25H30N4O/c1-16(2)29-15-18-11-23-21(20-7-4-8-22(29)24(18)20)10-19(14-28(23)3)25(30)27-13-17-6-5-9-26-12-17/h4-9,12,15-16,19,21,23H,10-11,13-14H2,1-3H3,(H,27,30)/t19-,21-,23-/m1/s1 |
| InChIKey | WYXWIIVISQZKRG-KJXAQDMKSA-N |
| XLogP | 3.89 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |