C27H39N3O — CID 54019048
(6aR,9R)-4-butyl-N-cycloheptyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 54019048) has the molecular formula C27H39N3O and a molecular weight of 421.63 g/mol. Its IUPAC name is (6aR,9R)-4-butyl-N-cycloheptyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-4-butyl-N-cycloheptyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 54019048 |
| Molecular Formula | C27H39N3O |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.31 |
| IUPAC Name | (6aR,9R)-4-butyl-N-cycloheptyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCCCn1cc2c3c(cccc31)C1C[C@@H](C(=O)NC3CCCCCC3)CN(C)[C@@H]1C2 |
| InChI | InChI=1S/C27H39N3O/c1-3-4-14-30-18-19-16-25-23(22-12-9-13-24(30)26(19)22)15-20(17-29(25)2)27(31)28-21-10-7-5-6-8-11-21/h9,12-13,18,20-21,23,25H,3-8,10-11,14-17H2,1-2H3,(H,28,31)/t20-,23?,25-/m1/s1 |
| InChIKey | KXQIZSIKHVRCDF-GUNHNPDVSA-N |
| XLogP | 5.24 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|