C30H40N4O — CID 54108968
(6aR,9R)-4-butyl-N,7-dimethyl-N-(3-pyridin-2-ylbutan-2-yl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 54108968) has the molecular formula C30H40N4O and a molecular weight of 472.68 g/mol. Its IUPAC name is (6aR,9R)-4-butyl-N,7-dimethyl-N-(3-pyridin-2-ylbutan-2-yl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-4-butyl-N,7-dimethyl-N-(3-pyridin-2-ylbutan-2-yl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 54108968 |
| Molecular Formula | C30H40N4O |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | (6aR,9R)-4-butyl-N,7-dimethyl-N-(3-pyridin-2-ylbutan-2-yl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCCCn1cc2c3c(cccc31)C1C[C@@H](C(=O)N(C)C(C)C(C)c3ccccn3)CN(C)[C@@H]1C2 |
| InChI | InChI=1S/C30H40N4O/c1-6-7-15-34-19-22-17-28-25(24-11-10-13-27(34)29(22)24)16-23(18-32(28)4)30(35)33(5)21(3)20(2)26-12-8-9-14-31-26/h8-14,19-21,23,25,28H,6-7,15-18H2,1-5H3/t20?,21?,23-,25?,28-/m1/s1 |
| InChIKey | NFSSBCSWINFAQO-PPWKHDAQSA-N |
| XLogP | 5.45 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|