C22H27N3O7 — CID 57060447
1-O-[(6aR,10aR)-9-carbamoyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl] 4-O-ethyl 2,3-dihydroxybutanedioate (PubChem CID 57060447) has the molecular formula C22H27N3O7 and a molecular weight of 445.47 g/mol. Its IUPAC name is 1-O-[(6aR,10aR)-9-carbamoyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl] 4-O-ethyl 2,3-dihydroxybutanedioate.
| Compound Name | 1-O-[(6aR,10aR)-9-carbamoyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl] 4-O-ethyl 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 57060447 |
| Molecular Formula | C22H27N3O7 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 1-O-[(6aR,10aR)-9-carbamoyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-4-yl] 4-O-ethyl 2,3-dihydroxybutanedioate |
| SMILES | CCOC(=O)C(O)C(O)C(=O)On1cc2c3c(cccc31)[C@H]1CC(C(N)=O)CN(C)[C@@H]1C2 |
| InChI | InChI=1S/C22H27N3O7/c1-3-31-21(29)18(26)19(27)22(30)32-25-10-11-8-16-14(7-12(20(23)28)9-24(16)2)13-5-4-6-15(25)17(11)13/h4-6,10,12,14,16,18-19,26-27H,3,7-9H2,1-2H3,(H2,23,28)/t12?,14-,16-,18?,19?/m1/s1 |
| InChIKey | MNGQLAJDGXFKOS-VNPMYPFOSA-N |
| XLogP | -0.67 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |