C28H37N3O6 — CID 54583116
N-[(6aR,9R,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-4-methoxycyclohexane-1-carboxamide;(Z)-but-2-enedioic acid (PubChem CID 54583116) has the molecular formula C28H37N3O6 and a molecular weight of 511.62 g/mol. Its IUPAC name is N-[(6aR,9R,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-4-methoxycyclohexane-1-carboxamide;(Z)-but-2-enedioic acid.
| Compound Name | N-[(6aR,9R,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-4-methoxycyclohexane-1-carboxamide;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 54583116 |
| Molecular Formula | C28H37N3O6 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | N-[(6aR,9R,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-4-methoxycyclohexane-1-carboxamide;(Z)-but-2-enedioic acid |
| SMILES | COC1CCC(C(=O)N[C@@H]2C[C@@H]3c4cccc5c4c(cn5C)C[C@H]3N(C)C2)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C24H33N3O2.C4H4O4/c1-26-13-16-11-22-20(19-5-4-6-21(26)23(16)19)12-17(14-27(22)2)25-24(28)15-7-9-18(29-3)10-8-15;5-3(6)1-2-4(7)8/h4-6,13,15,17-18,20,22H,7-12,14H2,1-3H3,(H,25,28);1-2H,(H,5,6)(H,7,8)/b;2-1-/t15?,17-,18?,20-,22-;/m1./s1 |
| InChIKey | CVRCKOAOPWTJGE-VLFCCIMLSA-N |
| XLogP | 2.92 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|