C22H30N4O — CID 156599345
N-[(6aR,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]piperidine-1-carboxamide (PubChem CID 156599345) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[(6aR,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]piperidine-1-carboxamide.
| Compound Name | N-[(6aR,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 156599345 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | N-[(6aR,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]piperidine-1-carboxamide |
| SMILES | CN1CC(NC(=O)N2CCCCC2)C[C@@H]2c3cccc4c3c(cn4C)C[C@H]21 |
| InChI | InChI=1S/C22H30N4O/c1-24-13-15-11-20-18(17-7-6-8-19(24)21(15)17)12-16(14-25(20)2)23-22(27)26-9-4-3-5-10-26/h6-8,13,16,18,20H,3-5,9-12,14H2,1-2H3,(H,23,27)/t16?,18-,20-/m1/s1 |
| InChIKey | KSDOLKMKKCCNFE-PUGIBVIZSA-N |
| XLogP | 3.09 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|