C29H45N5O2 — CID 143733613
N-[3-(dimethylamino)propyl]-N-(ethylcarbamoyl)-4-methyl-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide;ethane (PubChem CID 143733613) has the molecular formula C29H45N5O2 and a molecular weight of 495.71 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-(ethylcarbamoyl)-4-methyl-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide;ethane.
| Compound Name | N-[3-(dimethylamino)propyl]-N-(ethylcarbamoyl)-4-methyl-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide;ethane |
|---|---|
| PubChem CID | 143733613 |
| Molecular Formula | C29H45N5O2 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.36 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-(ethylcarbamoyl)-4-methyl-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide;ethane |
| SMILES | C=CCN1CC(C(=O)N(CCCN(C)C)C(=O)NCC)CC2c3cccc4c3c(cn4C)CC21.CC |
| InChI | InChI=1S/C27H39N5O2.C2H6/c1-6-12-31-18-20(26(33)32(27(34)28-7-2)14-9-13-29(3)4)15-22-21-10-8-11-23-25(21)19(16-24(22)31)17-30(23)5;1-2/h6,8,10-11,17,20,22,24H,1,7,9,12-16,18H2,2-5H3,(H,28,34);1-2H3 |
| InChIKey | RYUOXEXKJUOABJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 60.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|