C25H37N3O — CID 173375710
(6aR)-7-ethyl-N-pentyl-4-propan-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 173375710) has the molecular formula C25H37N3O and a molecular weight of 395.59 g/mol. Its IUPAC name is (6aR)-7-ethyl-N-pentyl-4-propan-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR)-7-ethyl-N-pentyl-4-propan-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 173375710 |
| Molecular Formula | C25H37N3O |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | (6aR)-7-ethyl-N-pentyl-4-propan-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCCCCNC(=O)C1CC2c3cccc4c3c(cn4C(C)C)C[C@H]2N(CC)C1 |
| InChI | InChI=1S/C25H37N3O/c1-5-7-8-12-26-25(29)19-13-21-20-10-9-11-22-24(20)18(16-28(22)17(3)4)14-23(21)27(6-2)15-19/h9-11,16-17,19,21,23H,5-8,12-15H2,1-4H3,(H,26,29)/t19?,21?,23-/m1/s1 |
| InChIKey | XUEHGHUOCFHAEA-POOLCLQXSA-N |
| XLogP | 4.88 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|