C26H37ClN2O2 — CID 67833447
cyclohexyl (6aR,9R)-7-ethyl-4-propan-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate;hydrochloride (PubChem CID 67833447) has the molecular formula C26H37ClN2O2 and a molecular weight of 445.05 g/mol. Its IUPAC name is cyclohexyl (6aR,9R)-7-ethyl-4-propan-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate;hydrochloride.
| Compound Name | cyclohexyl (6aR,9R)-7-ethyl-4-propan-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 67833447 |
| Molecular Formula | C26H37ClN2O2 |
| Molecular Weight | 445.05 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | cyclohexyl (6aR,9R)-7-ethyl-4-propan-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate;hydrochloride |
| SMILES | CCN1C[C@H](C(=O)OC2CCCCC2)CC2c3cccc4c3c(cn4C(C)C)C[C@H]21.Cl |
| InChI | InChI=1S/C26H36N2O2.ClH/c1-4-27-15-19(26(29)30-20-9-6-5-7-10-20)13-22-21-11-8-12-23-25(21)18(14-24(22)27)16-28(23)17(2)3;/h8,11-12,16-17,19-20,22,24H,4-7,9-10,13-15H2,1-3H3;1H/t19-,22?,24-;/m1./s1 |
| InChIKey | MNQDKLPAKAOGQP-UBJJKBSGSA-N |
| XLogP | 5.87 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.05 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |