C22H29N3O4S — CID 70528473
(Z)-but-2-enedioic acid;(2R,4R,7R)-4-(methylsulfanylmethyl)-6-propyl-6,10,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9(16),11,13-tetraene (PubChem CID 70528473) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(2R,4R,7R)-4-(methylsulfanylmethyl)-6-propyl-6,10,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9(16),11,13-tetraene.
| Compound Name | (Z)-but-2-enedioic acid;(2R,4R,7R)-4-(methylsulfanylmethyl)-6-propyl-6,10,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9(16),11,13-tetraene |
|---|---|
| PubChem CID | 70528473 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (Z)-but-2-enedioic acid;(2R,4R,7R)-4-(methylsulfanylmethyl)-6-propyl-6,10,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9(16),11,13-tetraene |
| SMILES | CCCN1C[C@H](CSC)C[C@@H]2c3cccc4n[nH]c(c34)C[C@H]21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H25N3S.C4H4O4/c1-3-7-21-10-12(11-22-2)8-14-13-5-4-6-15-18(13)16(20-19-15)9-17(14)21;5-3(6)1-2-4(7)8/h4-6,12,14,17H,3,7-11H2,1-2H3,(H,19,20);1-2H,(H,5,6)(H,7,8)/b;2-1-/t12-,14-,17-;/m1./s1 |
| InChIKey | PABRQIRUZNQOSQ-HWTWYRAJSA-N |
| XLogP | 3.38 |
| TPSA | 106.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|