C18H25N3O — CID 57047379
(2R,7R)-4-(methoxymethyl)-6-propyl-6,10,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9(16),11,13-tetraene (PubChem CID 57047379) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is (2R,7R)-4-(methoxymethyl)-6-propyl-6,10,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9(16),11,13-tetraene.
| Compound Name | (2R,7R)-4-(methoxymethyl)-6-propyl-6,10,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9(16),11,13-tetraene |
|---|---|
| PubChem CID | 57047379 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | (2R,7R)-4-(methoxymethyl)-6-propyl-6,10,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9(16),11,13-tetraene |
| SMILES | CCCN1CC(COC)C[C@@H]2c3cccc4n[nH]c(c34)C[C@H]21 |
| InChI | InChI=1S/C18H25N3O/c1-3-7-21-10-12(11-22-2)8-14-13-5-4-6-15-18(13)16(20-19-15)9-17(14)21/h4-6,12,14,17H,3,7-11H2,1-2H3,(H,19,20)/t12?,14-,17-/m1/s1 |
| InChIKey | JZFYMDYWUAVHAR-MRXJRLSOSA-N |
| XLogP | 2.95 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |