C26H36N2O4S — CID 163285468
ditert-butyl (6aR,9S,10aR)-9-(methylsulfanylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-4,7-dicarboxylate (PubChem CID 163285468) has the molecular formula C26H36N2O4S and a molecular weight of 472.65 g/mol. Its IUPAC name is ditert-butyl (6aR,9S,10aR)-9-(methylsulfanylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-4,7-dicarboxylate.
| Compound Name | ditert-butyl (6aR,9S,10aR)-9-(methylsulfanylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-4,7-dicarboxylate |
|---|---|
| PubChem CID | 163285468 |
| Molecular Formula | C26H36N2O4S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | ditert-butyl (6aR,9S,10aR)-9-(methylsulfanylmethyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-4,7-dicarboxylate |
| SMILES | CSC[C@H]1C[C@@H]2c3cccc4c3c(cn4C(=O)OC(C)(C)C)C[C@H]2N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C26H36N2O4S/c1-25(2,3)31-23(29)27-13-16(15-33-7)11-19-18-9-8-10-20-22(18)17(12-21(19)27)14-28(20)24(30)32-26(4,5)6/h8-10,14,16,19,21H,11-13,15H2,1-7H3/t16-,19+,21+/m0/s1 |
| InChIKey | VJDDTQUGIJPUSC-LDQXTDLNSA-N |
| XLogP | 6.05 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |