C17H30N2O4S — CID 162497387
ditert-butyl (1R,7S)-4-(sulfanylmethyl)-2,6-diazabicyclo[5.1.0]octane-2,6-dicarboxylate (PubChem CID 162497387) has the molecular formula C17H30N2O4S and a molecular weight of 358.50 g/mol. Its IUPAC name is ditert-butyl (1R,7S)-4-(sulfanylmethyl)-2,6-diazabicyclo[5.1.0]octane-2,6-dicarboxylate.
| Compound Name | ditert-butyl (1R,7S)-4-(sulfanylmethyl)-2,6-diazabicyclo[5.1.0]octane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 162497387 |
| Molecular Formula | C17H30N2O4S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | ditert-butyl (1R,7S)-4-(sulfanylmethyl)-2,6-diazabicyclo[5.1.0]octane-2,6-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CS)CN(C(=O)OC(C)(C)C)[C@H]2C[C@H]21 |
| InChI | InChI=1S/C17H30N2O4S/c1-16(2,3)22-14(20)18-8-11(10-24)9-19(13-7-12(13)18)15(21)23-17(4,5)6/h11-13,24H,7-10H2,1-6H3/t11?,12-,13+ |
| InChIKey | XVJQOAMRCNTBNZ-YHWZYXNKSA-N |
| XLogP | 3.16 |
| TPSA | 59.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|