C14H17NO2 — CID 89059424
tert-butyl (1aS,6aR)-6,6a-dihydro-1aH-indeno[1,2-b]azirine-1-carboxylate (PubChem CID 89059424) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is tert-butyl (1aS,6aR)-6,6a-dihydro-1aH-indeno[1,2-b]azirine-1-carboxylate.
| Compound Name | tert-butyl (1aS,6aR)-6,6a-dihydro-1aH-indeno[1,2-b]azirine-1-carboxylate |
|---|---|
| PubChem CID | 89059424 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | tert-butyl (1aS,6aR)-6,6a-dihydro-1aH-indeno[1,2-b]azirine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2Cc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C14H17NO2/c1-14(2,3)17-13(16)15-11-8-9-6-4-5-7-10(9)12(11)15/h4-7,11-12H,8H2,1-3H3/t11-,12+,15?/m1/s1 |
| InChIKey | BRKUDJZZOLFPEL-ZVORSSOTSA-N |
| XLogP | 2.90 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|