C28H31NO4 — CID 159996731
3,3a,4,8b-tetrahydro-1H-cyclopenta[a]inden-2-one;tert-butyl 2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrole-1-carboxylate (PubChem CID 159996731) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is 3,3a,4,8b-tetrahydro-1H-cyclopenta[a]inden-2-one;tert-butyl 2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrole-1-carboxylate.
| Compound Name | 3,3a,4,8b-tetrahydro-1H-cyclopenta[a]inden-2-one;tert-butyl 2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 159996731 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 3,3a,4,8b-tetrahydro-1H-cyclopenta[a]inden-2-one;tert-butyl 2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC2Cc3ccccc3C21.O=C1CC2Cc3ccccc3C2C1 |
| InChI | InChI=1S/C16H19NO3.C12H12O/c1-16(2,3)20-15(19)17-13(18)9-11-8-10-6-4-5-7-12(10)14(11)17;13-10-6-9-5-8-3-1-2-4-11(8)12(9)7-10/h4-7,11,14H,8-9H2,1-3H3;1-4,9,12H,5-7H2 |
| InChIKey | OHQCEUOYGZYDGQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |