C17H19NO4 — CID 67975730
tert-butyl (3Z)-3-(hydroxymethylidene)-2-oxo-4,8b-dihydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate (PubChem CID 67975730) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is tert-butyl (3Z)-3-(hydroxymethylidene)-2-oxo-4,8b-dihydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (3Z)-3-(hydroxymethylidene)-2-oxo-4,8b-dihydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 67975730 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | tert-butyl (3Z)-3-(hydroxymethylidene)-2-oxo-4,8b-dihydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)/C(=C\O)C2Cc3ccccc3C21 |
| InChI | InChI=1S/C17H19NO4/c1-17(2,3)22-16(21)18-14-11-7-5-4-6-10(11)8-12(14)13(9-19)15(18)20/h4-7,9,12,14,19H,8H2,1-3H3/b13-9- |
| InChIKey | ZXSXZNVCDMAZFR-LCYFTJDESA-N |
| XLogP | 3.12 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|