C22H23NO6 — CID 177397765
tert-butyl (2S)-2-[(Z)-[(3aR,8bS)-2-oxo-4,8b-dihydro-3aH-indeno[1,2-b]furan-3-ylidene]methoxy]-4-methyl-5-oxo-2H-pyrrole-1-carboxylate (PubChem CID 177397765) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(Z)-[(3aR,8bS)-2-oxo-4,8b-dihydro-3aH-indeno[1,2-b]furan-3-ylidene]methoxy]-4-methyl-5-oxo-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(Z)-[(3aR,8bS)-2-oxo-4,8b-dihydro-3aH-indeno[1,2-b]furan-3-ylidene]methoxy]-4-methyl-5-oxo-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 177397765 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | tert-butyl (2S)-2-[(Z)-[(3aR,8bS)-2-oxo-4,8b-dihydro-3aH-indeno[1,2-b]furan-3-ylidene]methoxy]-4-methyl-5-oxo-2H-pyrrole-1-carboxylate |
| SMILES | CC1=C[C@H](O/C=C2\C(=O)O[C@@H]3c4ccccc4C[C@H]23)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C22H23NO6/c1-12-9-17(23(19(12)24)21(26)29-22(2,3)4)27-11-16-15-10-13-7-5-6-8-14(13)18(15)28-20(16)25/h5-9,11,15,17-18H,10H2,1-4H3/b16-11-/t15-,17+,18-/m1/s1 |
| InChIKey | IXMRLCLYDIWTKQ-HSTQQDDNSA-N |
| XLogP | 3.41 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|