C22H27NO6 — CID 123598241
tert-butyl (3aR,4aS,8bS)-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-2-oxo-4,4a,5,6,7,8b-hexahydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate (PubChem CID 123598241) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is tert-butyl (3aR,4aS,8bS)-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-2-oxo-4,4a,5,6,7,8b-hexahydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (3aR,4aS,8bS)-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-2-oxo-4,4a,5,6,7,8b-hexahydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 123598241 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | tert-butyl (3aR,4aS,8bS)-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-2-oxo-4,4a,5,6,7,8b-hexahydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate |
| SMILES | CC1=C[C@@H](OC=C2C(=O)N(C(=O)OC(C)(C)C)[C@@H]3C4=CCCC[C@H]4C[C@H]23)OC1=O |
| InChI | InChI=1S/C22H27NO6/c1-12-9-17(28-20(12)25)27-11-16-15-10-13-7-5-6-8-14(13)18(15)23(19(16)24)21(26)29-22(2,3)4/h8-9,11,13,15,17-18H,5-7,10H2,1-4H3/t13-,15+,17-,18+/m0/s1 |
| InChIKey | XAEBJWYMAQFVBR-UNQWWWNPSA-N |
| XLogP | 3.61 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|