C16H21NO6 — CID 140686786
tert-butyl (3E)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-2-oxopiperidine-1-carboxylate (PubChem CID 140686786) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is tert-butyl (3E)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-2-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (3E)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-2-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 140686786 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | tert-butyl (3E)-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-2-oxopiperidine-1-carboxylate |
| SMILES | CC1=CC(O/C=C2\CCCN(C(=O)OC(C)(C)C)C2=O)OC1=O |
| InChI | InChI=1S/C16H21NO6/c1-10-8-12(22-14(10)19)21-9-11-6-5-7-17(13(11)18)15(20)23-16(2,3)4/h8-9,12H,5-7H2,1-4H3/b11-9+ |
| InChIKey | MLZOOOUUMGKQGP-PKNBQFBNSA-N |
| XLogP | 2.27 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|