C25H38N2O6 — CID 10389621
tert-butyl (3E)-3-[(5Z)-5-[1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperidin-3-ylidene]pentylidene]-2-oxopiperidine-1-carboxylate (PubChem CID 10389621) has the molecular formula C25H38N2O6 and a molecular weight of 462.59 g/mol. Its IUPAC name is tert-butyl (3E)-3-[(5Z)-5-[1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperidin-3-ylidene]pentylidene]-2-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (3E)-3-[(5Z)-5-[1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperidin-3-ylidene]pentylidene]-2-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 10389621 |
| Molecular Formula | C25H38N2O6 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | tert-butyl (3E)-3-[(5Z)-5-[1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperidin-3-ylidene]pentylidene]-2-oxopiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC/C(=C/CCC/C=C2\CCCN(C(=O)OC(C)(C)C)C2=O)C1=O |
| InChI | InChI=1S/C25H38N2O6/c1-24(2,3)32-22(30)26-16-10-14-18(20(26)28)12-8-7-9-13-19-15-11-17-27(21(19)29)23(31)33-25(4,5)6/h12-13H,7-11,14-17H2,1-6H3/b18-12-,19-13+ |
| InChIKey | CIXZHTQWGXIPIC-MGYAYREDSA-N |
| XLogP | 5.12 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|