C18H20O5 — CID 10969114
(3E,3aR,8S,8bS)-8-methyl-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-4,5,6,7,8,8b-hexahydro-3aH-indeno[1,2-b]furan-2-one (PubChem CID 10969114) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is (3E,3aR,8S,8bS)-8-methyl-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-4,5,6,7,8,8b-hexahydro-3aH-indeno[1,2-b]furan-2-one.
| Compound Name | (3E,3aR,8S,8bS)-8-methyl-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-4,5,6,7,8,8b-hexahydro-3aH-indeno[1,2-b]furan-2-one |
|---|---|
| PubChem CID | 10969114 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (3E,3aR,8S,8bS)-8-methyl-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-4,5,6,7,8,8b-hexahydro-3aH-indeno[1,2-b]furan-2-one |
| SMILES | CC1=C[C@@H](O/C=C2/C(=O)O[C@@H]3C4=C(CCC[C@@H]4C)C[C@H]23)OC1=O |
| InChI | InChI=1S/C18H20O5/c1-9-4-3-5-11-7-12-13(18(20)23-16(12)15(9)11)8-21-14-6-10(2)17(19)22-14/h6,8-9,12,14,16H,3-5,7H2,1-2H3/b13-8+/t9-,12+,14-,16-/m0/s1 |
| InChIKey | KHSREFIWULNDAB-VPUAZBNXSA-N |
| XLogP | 2.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|