C14H16O6 — CID 157101567
(2R)-2-[(E)-[(3aS,6aS)-4,5-dihydroxy-2-oxo-3,3a,4,5,6,6a-hexahydropentalen-1-ylidene]methoxy]-4-methyl-2H-furan-5-one (PubChem CID 157101567) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is (2R)-2-[(E)-[(3aS,6aS)-4,5-dihydroxy-2-oxo-3,3a,4,5,6,6a-hexahydropentalen-1-ylidene]methoxy]-4-methyl-2H-furan-5-one.
| Compound Name | (2R)-2-[(E)-[(3aS,6aS)-4,5-dihydroxy-2-oxo-3,3a,4,5,6,6a-hexahydropentalen-1-ylidene]methoxy]-4-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 157101567 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (2R)-2-[(E)-[(3aS,6aS)-4,5-dihydroxy-2-oxo-3,3a,4,5,6,6a-hexahydropentalen-1-ylidene]methoxy]-4-methyl-2H-furan-5-one |
| SMILES | CC1=C[C@H](O/C=C2/C(=O)C[C@@H]3C(O)C(O)C[C@H]23)OC1=O |
| InChI | InChI=1S/C14H16O6/c1-6-2-12(20-14(6)18)19-5-9-7-3-11(16)13(17)8(7)4-10(9)15/h2,5,7-8,11-13,16-17H,3-4H2,1H3/b9-5+/t7-,8-,11?,12+,13?/m0/s1 |
| InChIKey | KPSRGBVATDPNDT-XYBVFRMRSA-N |
| XLogP | 0.05 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|